C22H14F2N2O3 — CID 7204931
3-benzamido-N-(3,4-difluorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 7204931) has the molecular formula C22H14F2N2O3 and a molecular weight of 392.36 g/mol. Its IUPAC name is 3-benzamido-N-(3,4-difluorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-benzamido-N-(3,4-difluorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7204931 |
| Molecular Formula | C22H14F2N2O3 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-benzamido-N-(3,4-difluorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1c(C(=O)Nc2ccc(F)c(F)c2)oc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H14F2N2O3/c23-16-11-10-14(12-17(16)24)25-22(28)20-19(15-8-4-5-9-18(15)29-20)26-21(27)13-6-2-1-3-7-13/h1-12H,(H,25,28)(H,26,27) |
| InChIKey | HUKCRAHRHADLPD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |