C8H12N4O2 — CID 146826444
5-cyclopropyl-N-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 146826444) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-cyclopropyl-N-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 146826444 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-cyclopropyl-N-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CNCNC(=O)c1noc(C2CC2)n1 |
| InChI | InChI=1S/C8H12N4O2/c1-9-4-10-7(13)6-11-8(14-12-6)5-2-3-5/h5,9H,2-4H2,1H3,(H,10,13) |
| InChIKey | SDBJFMMZGCKZJK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|