C7H9ClN2O2S — CID 117259808
3-(2-chloro-1H-imidazol-5-yl)thiolane 1,1-dioxide (PubChem CID 117259808) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 3-(2-chloro-1H-imidazol-5-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(2-chloro-1H-imidazol-5-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117259808 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3-(2-chloro-1H-imidazol-5-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2cnc(Cl)[nH]2)C1 |
| InChI | InChI=1S/C7H9ClN2O2S/c8-7-9-3-6(10-7)5-1-2-13(11,12)4-5/h3,5H,1-2,4H2,(H,9,10) |
| InChIKey | XXXUDSFFAQRGFR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |