C9H11N5O2S — CID 114608252
8-(1,1-dioxothiolan-3-yl)-7H-purin-6-amine (PubChem CID 114608252) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is 8-(1,1-dioxothiolan-3-yl)-7H-purin-6-amine.
| Compound Name | 8-(1,1-dioxothiolan-3-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114608252 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 8-(1,1-dioxothiolan-3-yl)-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(C3CCS(=O)(=O)C3)[nH]c12 |
| InChI | InChI=1S/C9H11N5O2S/c10-7-6-9(12-4-11-7)14-8(13-6)5-1-2-17(15,16)3-5/h4-5H,1-3H2,(H3,10,11,12,13,14) |
| InChIKey | SDWRMNRGAHXAFY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |