C14H14N6 — CID 114607890
8-(1,2,3,4-tetrahydroisoquinolin-4-yl)-7H-purin-6-amine (PubChem CID 114607890) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 8-(1,2,3,4-tetrahydroisoquinolin-4-yl)-7H-purin-6-amine.
| Compound Name | 8-(1,2,3,4-tetrahydroisoquinolin-4-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114607890 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 8-(1,2,3,4-tetrahydroisoquinolin-4-yl)-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(C3CNCc4ccccc43)[nH]c12 |
| InChI | InChI=1S/C14H14N6/c15-12-11-14(18-7-17-12)20-13(19-11)10-6-16-5-8-3-1-2-4-9(8)10/h1-4,7,10,16H,5-6H2,(H3,15,17,18,19,20) |
| InChIKey | JAIXPYNKOJYUDW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |