C17H16N2 — CID 129383682
(4R)-4-(1H-indol-2-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 129383682) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (4R)-4-(1H-indol-2-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (4R)-4-(1H-indol-2-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 129383682 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (4R)-4-(1H-indol-2-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNC[C@@H]2c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H16N2/c1-3-7-14-13(6-1)10-18-11-15(14)17-9-12-5-2-4-8-16(12)19-17/h1-9,15,18-19H,10-11H2/t15-/m0/s1 |
| InChIKey | UDKNFVYZFLKFST-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |