About 4-chloro-1,2,3,4-tetrahydroisoquinoline
4-chloro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 91517111) has the molecular formula C9H10ClN
and a molecular weight of 167.64 g/mol. Its IUPAC name is 4-chloro-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 4-chloro-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 91517111 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4-chloro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | ClC1CNCc2ccccc21 |
| InChI | InChI=1S/C9H10ClN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4,9,11H,5-6H2 |
| InChIKey | FFVJTLNGRRBMMJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 4-chloro-1,2,3,4-tetrahydroisoquinoline (CID 91517111) is 4-chloro-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 4-chloro-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 4-chloro-1,2,3,4-tetrahydroisoquinoline is ClC1CNCc2ccccc21.
What is the InChIKey of 4-chloro-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is FFVJTLNGRRBMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4,9,11H,5-6H2.
What are the key properties of 4-chloro-1,2,3,4-tetrahydroisoquinoline?
4-chloro-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 167.64 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 91517111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).