C9H10ClN — CID 91517111
4-chloro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 91517111) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is 4-chloro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-chloro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 91517111 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4-chloro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | ClC1CNCc2ccccc21 |
| InChI | InChI=1S/C9H10ClN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4,9,11H,5-6H2 |
| InChIKey | FFVJTLNGRRBMMJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|