C12H13N3 — CID 54594300
4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 54594300) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 54594300 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNCC2n1cccn1 |
| InChI | InChI=1S/C12H13N3/c1-2-5-11-10(4-1)8-13-9-12(11)15-7-3-6-14-15/h1-7,12-13H,8-9H2 |
| InChIKey | PBSOISQSZIYBJI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |