About 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline
4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 54594300) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 54594300 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNCC2n1cccn1 |
| InChI | InChI=1S/C12H13N3/c1-2-5-11-10(4-1)8-13-9-12(11)15-7-3-6-14-15/h1-7,12-13H,8-9H2 |
| InChIKey | PBSOISQSZIYBJI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline (CID 54594300) is 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline is c1ccc2c(c1)CNCC2n1cccn1.
What is the InChIKey of 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is PBSOISQSZIYBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3/c1-2-5-11-10(4-1)8-13-9-12(11)15-7-3-6-14-15/h1-7,12-13H,8-9H2.
What are the key properties of 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline?
4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 199.26 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-yl-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 54594300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).