C18H26N2 — CID 102726652
4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 102726652) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 102726652 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNCC2N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H26N2/c1-3-9-16-15(7-1)12-19-13-18(16)20-11-5-8-14-6-2-4-10-17(14)20/h1,3,7,9,14,17-19H,2,4-6,8,10-13H2/t14-,17-,18?/m1/s1 |
| InChIKey | AAFAJTWCSUIFTP-OMOCGIRRSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |