C18H26N2O — CID 102725956
3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 102725956) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 102725956 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1c2ccccc2OCC1N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H26N2O/c19-18-14-8-2-4-10-17(14)21-12-16(18)20-11-5-7-13-6-1-3-9-15(13)20/h2,4,8,10,13,15-16,18H,1,3,5-7,9,11-12,19H2/t13-,15-,16?,18?/m1/s1 |
| InChIKey | LMJFKOMNOIRCNQ-GRFMFAJESA-N |
| XLogP | 3.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |