C14H25NO — CID 90725395
ethane;4-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 90725395) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;4-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | ethane;4-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 90725395 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;4-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC.CC.COC1CNCc2ccccc21 |
| InChI | InChI=1S/C10H13NO.2C2H6/c1-12-10-7-11-6-8-4-2-3-5-9(8)10;2*1-2/h2-5,10-11H,6-7H2,1H3;2*1-2H3 |
| InChIKey | GMBIXKDHZBTBAN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |