C17H15NO — CID 129394122
(4R)-4-(1-benzofuran-5-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 129394122) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is (4R)-4-(1-benzofuran-5-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (4R)-4-(1-benzofuran-5-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 129394122 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (4R)-4-(1-benzofuran-5-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNC[C@@H]2c1ccc2occc2c1 |
| InChI | InChI=1S/C17H15NO/c1-2-4-15-14(3-1)10-18-11-16(15)12-5-6-17-13(9-12)7-8-19-17/h1-9,16,18H,10-11H2/t16-/m1/s1 |
| InChIKey | OXXAACBFGXDZHK-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |