C21H24BNO2 — CID 144727117
ethane;[(4S)-4-naphthalen-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl]boronic acid (PubChem CID 144727117) has the molecular formula C21H24BNO2 and a molecular weight of 333.24 g/mol. Its IUPAC name is ethane;[(4S)-4-naphthalen-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl]boronic acid.
| Compound Name | ethane;[(4S)-4-naphthalen-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl]boronic acid |
|---|---|
| PubChem CID | 144727117 |
| Molecular Formula | C21H24BNO2 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethane;[(4S)-4-naphthalen-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl]boronic acid |
| SMILES | CC.OB(O)c1ccc2c(c1)CNC[C@H]2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H18BNO2.C2H6/c22-20(23)17-7-8-18-16(10-17)11-21-12-19(18)15-6-5-13-3-1-2-4-14(13)9-15;1-2/h1-10,19,21-23H,11-12H2;1-2H3/t19-;/m0./s1 |
| InChIKey | ZCLYIOSWJFFMTL-FYZYNONXSA-N |
| XLogP | 2.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|