C16H12Cl2F3NO3S — CID 86647718
[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate (PubChem CID 86647718) has the molecular formula C16H12Cl2F3NO3S and a molecular weight of 426.24 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86647718 |
| Molecular Formula | C16H12Cl2F3NO3S |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | [4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CNCC2c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C16H12Cl2F3NO3S/c17-14-4-1-9(6-15(14)18)13-8-22-7-10-5-11(2-3-12(10)13)25-26(23,24)16(19,20)21/h1-6,13,22H,7-8H2 |
| InChIKey | NKOGTNHHFRAQAH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|