C7H11N3O2S — CID 84670121
1-[(1,1-dioxothietan-3-yl)methyl]pyrazol-4-amine (PubChem CID 84670121) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-[(1,1-dioxothietan-3-yl)methyl]pyrazol-4-amine.
| Compound Name | 1-[(1,1-dioxothietan-3-yl)methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 84670121 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-[(1,1-dioxothietan-3-yl)methyl]pyrazol-4-amine |
| SMILES | Nc1cnn(CC2CS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C7H11N3O2S/c8-7-1-9-10(3-7)2-6-4-13(11,12)5-6/h1,3,6H,2,4-5,8H2 |
| InChIKey | IWFWIJVJHLAKHS-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |