C6H10N4O2S — CID 165480918
1-[(1,1-dioxothietan-3-yl)methyl]triazol-4-amine (PubChem CID 165480918) has the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. Its IUPAC name is 1-[(1,1-dioxothietan-3-yl)methyl]triazol-4-amine.
| Compound Name | 1-[(1,1-dioxothietan-3-yl)methyl]triazol-4-amine |
|---|---|
| PubChem CID | 165480918 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 1-[(1,1-dioxothietan-3-yl)methyl]triazol-4-amine |
| SMILES | Nc1cn(CC2CS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C6H10N4O2S/c7-6-2-10(9-8-6)1-5-3-13(11,12)4-5/h2,5H,1,3-4,7H2 |
| InChIKey | QEPVEXWFAOIZBE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |