C8H12N4O2 — CID 165440494
1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylic acid (PubChem CID 165440494) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 165440494 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylic acid |
| SMILES | NC1CC(Cn2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C8H12N4O2/c9-6-1-5(2-6)3-12-4-7(8(13)14)10-11-12/h4-6H,1-3,9H2,(H,13,14) |
| InChIKey | IETBPLVFXRPBPK-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |