C9H13FN4O2 — CID 121208487
1-[[1-(2-fluoroethyl)azetidin-3-yl]methyl]triazole-4-carboxylic acid (PubChem CID 121208487) has the molecular formula C9H13FN4O2 and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-[[1-(2-fluoroethyl)azetidin-3-yl]methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[[1-(2-fluoroethyl)azetidin-3-yl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 121208487 |
| Molecular Formula | C9H13FN4O2 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[[1-(2-fluoroethyl)azetidin-3-yl]methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CC2CN(CCF)C2)nn1 |
| InChI | InChI=1S/C9H13FN4O2/c10-1-2-13-3-7(4-13)5-14-6-8(9(15)16)11-12-14/h6-7H,1-5H2,(H,15,16) |
| InChIKey | XQMNEPAWOPJUMZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |