C8H13N3O3 — CID 62227732
1-(5-hydroxypentyl)triazole-4-carboxylic acid (PubChem CID 62227732) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)triazole-4-carboxylic acid.
| Compound Name | 1-(5-hydroxypentyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62227732 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(5-hydroxypentyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCCCCO)nn1 |
| InChI | InChI=1S/C8H13N3O3/c12-5-3-1-2-4-11-6-7(8(13)14)9-10-11/h6,12H,1-5H2,(H,13,14) |
| InChIKey | PZKLRCQFFPEFNP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|