C11H16N6O2 — CID 103263440
1-[2-(3-pyrazol-1-ylpropylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103263440) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[2-(3-pyrazol-1-ylpropylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-pyrazol-1-ylpropylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103263440 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[2-(3-pyrazol-1-ylpropylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNCCCn2cccn2)nn1 |
| InChI | InChI=1S/C11H16N6O2/c18-11(19)10-9-17(15-14-10)8-5-12-3-1-6-16-7-2-4-13-16/h2,4,7,9,12H,1,3,5-6,8H2,(H,18,19) |
| InChIKey | NRSFVDLKXKAKGN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|