C11H19N5O3 — CID 43592179
1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]triazole-4-carboxylic acid (PubChem CID 43592179) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43592179 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCN2CCN(CCO)CC2)nn1 |
| InChI | InChI=1S/C11H19N5O3/c17-8-7-15-3-1-14(2-4-15)5-6-16-9-10(11(18)19)12-13-16/h9,17H,1-8H2,(H,18,19) |
| InChIKey | MQYSSANAGZGBPV-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |