C12H20N6O3S — CID 70759510
[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-(2-aminoethyl)triazol-4-yl]methanone (PubChem CID 70759510) has the molecular formula C12H20N6O3S and a molecular weight of 328.40 g/mol. Its IUPAC name is [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-(2-aminoethyl)triazol-4-yl]methanone.
| Compound Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-(2-aminoethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 70759510 |
| Molecular Formula | C12H20N6O3S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-(2-aminoethyl)triazol-4-yl]methanone |
| SMILES | CN1CCN(C(=O)c2cn(CCN)nn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C12H20N6O3S/c1-16-4-5-18(11-8-22(20,21)7-10(11)16)12(19)9-6-17(3-2-13)15-14-9/h6,10-11H,2-5,7-8,13H2,1H3/t10-,11+/m1/s1 |
| InChIKey | YTBAMUVGMKBCAR-MNOVXSKESA-N |
| XLogP | -2.21 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |