C15H23N7O — CID 70785601
[1-(2-aminoethyl)triazol-4-yl]-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone (PubChem CID 70785601) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is [1-(2-aminoethyl)triazol-4-yl]-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone.
| Compound Name | [1-(2-aminoethyl)triazol-4-yl]-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70785601 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [1-(2-aminoethyl)triazol-4-yl]-[4-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
| SMILES | Cc1cnn(CC2CCN(C(=O)c3cn(CCN)nn3)CC2)c1 |
| InChI | InChI=1S/C15H23N7O/c1-12-8-17-22(9-12)10-13-2-5-20(6-3-13)15(23)14-11-21(7-4-16)19-18-14/h8-9,11,13H,2-7,10,16H2,1H3 |
| InChIKey | QYOXUXHVHYAEGF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |