C15H23N7O — CID 70725503
[1-(2-aminoethyl)triazol-4-yl]-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 70725503) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is [1-(2-aminoethyl)triazol-4-yl]-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(2-aminoethyl)triazol-4-yl]-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70725503 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [1-(2-aminoethyl)triazol-4-yl]-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | CCc1cn[nH]c1C1CCN(C(=O)c2cn(CCN)nn2)CC1 |
| InChI | InChI=1S/C15H23N7O/c1-2-11-9-17-19-14(11)12-3-6-21(7-4-12)15(23)13-10-22(8-5-16)20-18-13/h9-10,12H,2-8,16H2,1H3,(H,17,19) |
| InChIKey | JDUVTBGEMHNWFJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |