C18H20F3N3O — CID 26358743
1-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(2,3,6-trifluorophenyl)ethanone (PubChem CID 26358743) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(2,3,6-trifluorophenyl)ethanone.
| Compound Name | 1-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(2,3,6-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 26358743 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[4-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(2,3,6-trifluorophenyl)ethanone |
| SMILES | CCc1cn[nH]c1C1CCN(C(=O)Cc2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C18H20F3N3O/c1-2-11-10-22-23-18(11)12-5-7-24(8-6-12)16(25)9-13-14(19)3-4-15(20)17(13)21/h3-4,10,12H,2,5-9H2,1H3,(H,22,23) |
| InChIKey | VWOPKVKAECOSKQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|