C18H17F7N4O — CID 23645925
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(1,1,2,2,2-pentafluoroethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one (PubChem CID 23645925) has the molecular formula C18H17F7N4O and a molecular weight of 438.35 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(1,1,2,2,2-pentafluoroethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(1,1,2,2,2-pentafluoroethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 23645925 |
| Molecular Formula | C18H17F7N4O |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(1,1,2,2,2-pentafluoroethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCc2[nH]nc(C(F)(F)C(F)(F)F)c2C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C18H17F7N4O/c19-10-1-2-13(20)9(5-10)6-11(26)7-15(30)29-4-3-14-12(8-29)16(28-27-14)17(21,22)18(23,24)25/h1-2,5,11H,3-4,6-8,26H2,(H,27,28)/t11-/m1/s1 |
| InChIKey | VLKUCSKVQBSYBF-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|