C19H18F8N4O — CID 23645921
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one (PubChem CID 23645921) has the molecular formula C19H18F8N4O and a molecular weight of 470.36 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 23645921 |
| Molecular Formula | C19H18F8N4O |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCc2c(c(C(F)(F)F)nn2CC(F)(F)F)C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C19H18F8N4O/c20-11-1-2-14(21)10(5-11)6-12(28)7-16(32)30-4-3-15-13(8-30)17(19(25,26)27)29-31(15)9-18(22,23)24/h1-2,5,12H,3-4,6-9,28H2/t12-/m1/s1 |
| InChIKey | QUTYSRGNWJBZBW-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |