C22H21F3N4O — CID 23645928
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one (PubChem CID 23645928) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 23645928 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCc2[nH]nc(-c3ccc(F)cc3)c2C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C22H21F3N4O/c23-15-3-1-13(2-4-15)22-18-12-29(8-7-20(18)27-28-22)21(30)11-17(26)10-14-9-16(24)5-6-19(14)25/h1-6,9,17H,7-8,10-12,26H2,(H,27,28)/t17-/m1/s1 |
| InChIKey | OZNXZBJJNMKGAB-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |