C10H16N4O2 — CID 123848146
3-[(4-aminopyrazol-1-yl)methyl]piperidine-1-carboxylic acid (PubChem CID 123848146) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[(4-aminopyrazol-1-yl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(4-aminopyrazol-1-yl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123848146 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-[(4-aminopyrazol-1-yl)methyl]piperidine-1-carboxylic acid |
| SMILES | Nc1cnn(CC2CCCN(C(=O)O)C2)c1 |
| InChI | InChI=1S/C10H16N4O2/c11-9-4-12-14(7-9)6-8-2-1-3-13(5-8)10(15)16/h4,7-8H,1-3,5-6,11H2,(H,15,16) |
| InChIKey | LHRLKLSUCZLOPQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |