C10H13ClN2O2S — CID 117105423
4-[(5-chloropyridazin-3-yl)methyl]thiane 1,1-dioxide (PubChem CID 117105423) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 4-[(5-chloropyridazin-3-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 4-[(5-chloropyridazin-3-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117105423 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-[(5-chloropyridazin-3-yl)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cc2cc(Cl)cnn2)CC1 |
| InChI | InChI=1S/C10H13ClN2O2S/c11-9-6-10(13-12-7-9)5-8-1-3-16(14,15)4-2-8/h6-8H,1-5H2 |
| InChIKey | XBGYIEWOTJSPKY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |