C10H13BrN2O3S — CID 117105429
5-bromo-3-[(1,1-dioxothian-4-yl)methyl]-1H-pyridazin-6-one (PubChem CID 117105429) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is 5-bromo-3-[(1,1-dioxothian-4-yl)methyl]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-3-[(1,1-dioxothian-4-yl)methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 117105429 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-bromo-3-[(1,1-dioxothian-4-yl)methyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(CC2CCS(=O)(=O)CC2)cc1Br |
| InChI | InChI=1S/C10H13BrN2O3S/c11-9-6-8(12-13-10(9)14)5-7-1-3-17(15,16)4-2-7/h6-7H,1-5H2,(H,13,14) |
| InChIKey | NVJNFNXIALFJCC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |