C9H11ClN2O3S — CID 117105285
5-chloro-3-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyridazin-6-one (PubChem CID 117105285) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is 5-chloro-3-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-3-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 117105285 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 5-chloro-3-[(1,1-dioxothiolan-3-yl)methyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(CC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C9H11ClN2O3S/c10-8-4-7(11-12-9(8)13)3-6-1-2-16(14,15)5-6/h4,6H,1-3,5H2,(H,12,13) |
| InChIKey | YTZKNGQQHUVOEK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |