C14H18N4O2S — CID 82569447
4-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]aniline (PubChem CID 82569447) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]aniline.
| Compound Name | 4-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 82569447 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]aniline |
| SMILES | Nc1ccc(Cc2nc(CC3CCS(=O)(=O)C3)n[nH]2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c15-12-3-1-10(2-4-12)7-13-16-14(18-17-13)8-11-5-6-21(19,20)9-11/h1-4,11H,5-9,15H2,(H,16,17,18) |
| InChIKey | BVNWAPRLTBNONC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|