C15H19N5O3S — CID 82569655
4-amino-N-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 82569655) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 4-amino-N-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 82569655 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-amino-N-[[3-[(1,1-dioxothiolan-3-yl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCc2nc(CC3CCS(=O)(=O)C3)n[nH]2)cc1 |
| InChI | InChI=1S/C15H19N5O3S/c16-12-3-1-11(2-4-12)15(21)17-8-14-18-13(19-20-14)7-10-5-6-24(22,23)9-10/h1-4,10H,5-9,16H2,(H,17,21)(H,18,19,20) |
| InChIKey | MUCIDRKOLOPQGB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|