C18H20N6O — CID 82569650
4-amino-N-[[3-[4-(dimethylamino)phenyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 82569650) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-amino-N-[[3-[4-(dimethylamino)phenyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-[4-(dimethylamino)phenyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 82569650 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-amino-N-[[3-[4-(dimethylamino)phenyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | CN(C)c1ccc(-c2n[nH]c(CNC(=O)c3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C18H20N6O/c1-24(2)15-9-5-12(6-10-15)17-21-16(22-23-17)11-20-18(25)13-3-7-14(19)8-4-13/h3-10H,11,19H2,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | WIVSZSMSQLJWBM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|