C18H19N5O3 — CID 82569660
4-amino-N-[[3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 82569660) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-amino-N-[[3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 82569660 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-amino-N-[[3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | COc1cccc(OC)c1-c1n[nH]c(CNC(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C18H19N5O3/c1-25-13-4-3-5-14(26-2)16(13)17-21-15(22-23-17)10-20-18(24)11-6-8-12(19)9-7-11/h3-9H,10,19H2,1-2H3,(H,20,24)(H,21,22,23) |
| InChIKey | BJFGPHSTDSADOQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|