C15H14N6O — CID 82569633
4-amino-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]benzamide (PubChem CID 82569633) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-amino-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]benzamide.
| Compound Name | 4-amino-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 82569633 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-amino-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCc2nc(-c3ccncc3)n[nH]2)cc1 |
| InChI | InChI=1S/C15H14N6O/c16-12-3-1-11(2-4-12)15(22)18-9-13-19-14(21-20-13)10-5-7-17-8-6-10/h1-8H,9,16H2,(H,18,22)(H,19,20,21) |
| InChIKey | VXRPCIZOVSUUNA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|