C20H22N6O — CID 166363008
8-(aminomethyl)-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 166363008) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 8-(aminomethyl)-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 8-(aminomethyl)-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 166363008 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 8-(aminomethyl)-N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | NCC1CCCc2ccc(C(=O)NCc3nc(-c4ccncc4)n[nH]3)cc21 |
| InChI | InChI=1S/C20H22N6O/c21-11-16-3-1-2-13-4-5-15(10-17(13)16)20(27)23-12-18-24-19(26-25-18)14-6-8-22-9-7-14/h4-10,16H,1-3,11-12,21H2,(H,23,27)(H,24,25,26) |
| InChIKey | BJDUTFXTSUMFKJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |