C17H16FN5O — CID 82568852
4-amino-N-[[3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 82568852) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-amino-N-[[3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 82568852 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-amino-N-[[3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCc2nc(Cc3ccc(F)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H16FN5O/c18-13-5-1-11(2-6-13)9-15-21-16(23-22-15)10-20-17(24)12-3-7-14(19)8-4-12/h1-8H,9-10,19H2,(H,20,24)(H,21,22,23) |
| InChIKey | XRWASMUSKNNHMP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|