C17H16N6O3 — CID 82568859
4-amino-N-[[3-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 82568859) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-amino-N-[[3-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 82568859 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-amino-N-[[3-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCc2nc(Cc3ccc([N+](=O)[O-])cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H16N6O3/c18-13-5-3-12(4-6-13)17(24)19-10-16-20-15(21-22-16)9-11-1-7-14(8-2-11)23(25)26/h1-8H,9-10,18H2,(H,19,24)(H,20,21,22) |
| InChIKey | MHIIZAZMVVEEJE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|