C16H12FN5O3 — CID 56827489
N-[[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-nitrobenzamide (PubChem CID 56827489) has the molecular formula C16H12FN5O3 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 56827489 |
| Molecular Formula | C16H12FN5O3 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-nitrobenzamide |
| SMILES | O=C(NCc1nc(-c2ccc(F)cc2)n[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12FN5O3/c17-12-5-1-10(2-6-12)15-19-14(20-21-15)9-18-16(23)11-3-7-13(8-4-11)22(24)25/h1-8H,9H2,(H,18,23)(H,19,20,21) |
| InChIKey | KVEYRVMUQZPGJZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|