C10H13ClN2O3S — CID 117106110
5-chloro-3-[(1,1-dioxothian-2-yl)methyl]-1H-pyridazin-6-one (PubChem CID 117106110) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 5-chloro-3-[(1,1-dioxothian-2-yl)methyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-3-[(1,1-dioxothian-2-yl)methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 117106110 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-chloro-3-[(1,1-dioxothian-2-yl)methyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(CC2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O3S/c11-9-6-7(12-13-10(9)14)5-8-3-1-2-4-17(8,15)16/h6,8H,1-5H2,(H,13,14) |
| InChIKey | PIXCYMWUSZJKCC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |