C11H15BrN2O3S — CID 117106203
2-[(5-bromo-6-methoxypyridazin-3-yl)methyl]thiane 1,1-dioxide (PubChem CID 117106203) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-[(5-bromo-6-methoxypyridazin-3-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[(5-bromo-6-methoxypyridazin-3-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117106203 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[(5-bromo-6-methoxypyridazin-3-yl)methyl]thiane 1,1-dioxide |
| SMILES | COc1nnc(CC2CCCCS2(=O)=O)cc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c1-17-11-10(12)7-8(13-14-11)6-9-4-2-3-5-18(9,15)16/h7,9H,2-6H2,1H3 |
| InChIKey | FTVAEJLNBUEWPQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |