C10H13ClN2O3S — CID 117105927
2-(5-chloro-6-methoxypyridazin-3-yl)thiane 1,1-dioxide (PubChem CID 117105927) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 2-(5-chloro-6-methoxypyridazin-3-yl)thiane 1,1-dioxide.
| Compound Name | 2-(5-chloro-6-methoxypyridazin-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117105927 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-(5-chloro-6-methoxypyridazin-3-yl)thiane 1,1-dioxide |
| SMILES | COc1nnc(C2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O3S/c1-16-10-7(11)6-8(12-13-10)9-4-2-3-5-17(9,14)15/h6,9H,2-5H2,1H3 |
| InChIKey | LMSSKRPAHHQLCY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |