C9H11BrN2O3S — CID 117105789
2-(5-bromo-6-methoxypyridazin-3-yl)thiolane 1,1-dioxide (PubChem CID 117105789) has the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. Its IUPAC name is 2-(5-bromo-6-methoxypyridazin-3-yl)thiolane 1,1-dioxide.
| Compound Name | 2-(5-bromo-6-methoxypyridazin-3-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117105789 |
| Molecular Formula | C9H11BrN2O3S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 2-(5-bromo-6-methoxypyridazin-3-yl)thiolane 1,1-dioxide |
| SMILES | COc1nnc(C2CCCS2(=O)=O)cc1Br |
| InChI | InChI=1S/C9H11BrN2O3S/c1-15-9-6(10)5-7(11-12-9)8-3-2-4-16(8,13)14/h5,8H,2-4H2,1H3 |
| InChIKey | NMLJZMVNHGQVCA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |