C9H13N3O2S — CID 117105830
6-(1,1-dioxothian-2-yl)pyridazin-4-amine (PubChem CID 117105830) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 6-(1,1-dioxothian-2-yl)pyridazin-4-amine.
| Compound Name | 6-(1,1-dioxothian-2-yl)pyridazin-4-amine |
|---|---|
| PubChem CID | 117105830 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-(1,1-dioxothian-2-yl)pyridazin-4-amine |
| SMILES | Nc1cnnc(C2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C9H13N3O2S/c10-7-5-8(12-11-6-7)9-3-1-2-4-15(9,13)14/h5-6,9H,1-4H2,(H2,10,12) |
| InChIKey | IHGIDYGXQAVSQX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |