C10H17N3O2S — CID 104523031
2-(4-propan-2-yl-1,2,4-triazol-3-yl)thiane 1,1-dioxide (PubChem CID 104523031) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(4-propan-2-yl-1,2,4-triazol-3-yl)thiane 1,1-dioxide.
| Compound Name | 2-(4-propan-2-yl-1,2,4-triazol-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104523031 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(4-propan-2-yl-1,2,4-triazol-3-yl)thiane 1,1-dioxide |
| SMILES | CC(C)n1cnnc1C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H17N3O2S/c1-8(2)13-7-11-12-10(13)9-5-3-4-6-16(9,14)15/h7-9H,3-6H2,1-2H3 |
| InChIKey | TZSPFZBLRKUUTO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |