C11H19N3O2S — CID 113422585
2-(4-tert-butyl-1,2,4-triazol-3-yl)thiane 1,1-dioxide (PubChem CID 113422585) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,2,4-triazol-3-yl)thiane 1,1-dioxide.
| Compound Name | 2-(4-tert-butyl-1,2,4-triazol-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 113422585 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(4-tert-butyl-1,2,4-triazol-3-yl)thiane 1,1-dioxide |
| SMILES | CC(C)(C)n1cnnc1C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H19N3O2S/c1-11(2,3)14-8-12-13-10(14)9-6-4-5-7-17(9,15)16/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZQKCIENDAICCMS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |