C11H14N4O2S — CID 117144113
3-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-amine (PubChem CID 117144113) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-amine.
| Compound Name | 3-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117144113 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-amine |
| SMILES | Nc1ccn2c(C3CCCCS3(=O)=O)nnc2c1 |
| InChI | InChI=1S/C11H14N4O2S/c12-8-4-5-15-10(7-8)13-14-11(15)9-3-1-2-6-18(9,16)17/h4-5,7,9H,1-3,6,12H2 |
| InChIKey | VWIQKFBHVKJZBB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |