C11H15N5 — CID 117143835
3-piperidin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-amine (PubChem CID 117143835) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-piperidin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-amine.
| Compound Name | 3-piperidin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117143835 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-piperidin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-amine |
| SMILES | Nc1ccn2c(C3CCNCC3)nnc2c1 |
| InChI | InChI=1S/C11H15N5/c12-9-3-6-16-10(7-9)14-15-11(16)8-1-4-13-5-2-8/h3,6-8,13H,1-2,4-5,12H2 |
| InChIKey | FOCAZHPEDGEXSU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |